C7H12OS2 — CID 14271501
(2S)-1-(1,3-dithian-2-ylidene)propan-2-ol (PubChem CID 14271501) has the molecular formula C7H12OS2 and a molecular weight of 176.31 g/mol. Its IUPAC name is (2S)-1-(1,3-dithian-2-ylidene)propan-2-ol.
| Compound Name | (2S)-1-(1,3-dithian-2-ylidene)propan-2-ol |
|---|---|
| PubChem CID | 14271501 |
| Molecular Formula | C7H12OS2 |
| Molecular Weight | 176.31 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | (2S)-1-(1,3-dithian-2-ylidene)propan-2-ol |
| SMILES | C[C@H](O)C=C1SCCCS1 |
| InChI | InChI=1S/C7H12OS2/c1-6(8)5-7-9-3-2-4-10-7/h5-6,8H,2-4H2,1H3/t6-/m0/s1 |
| InChIKey | FZDVUUAQDIBOKL-LURJTMIESA-N |
| XLogP | 2.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |