C8H14OS2 — CID 130130633
1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol (PubChem CID 130130633) has the molecular formula C8H14OS2 and a molecular weight of 190.33 g/mol. Its IUPAC name is 1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol.
| Compound Name | 1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 130130633 |
| Molecular Formula | C8H14OS2 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 1-(2-methyl-1,3-dithian-2-yl)prop-2-en-1-ol |
| SMILES | C=CC(O)C1(C)SCCCS1 |
| InChI | InChI=1S/C8H14OS2/c1-3-7(9)8(2)10-5-4-6-11-8/h3,7,9H,1,4-6H2,2H3 |
| InChIKey | WVZOPRGJCZUXFF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|