C7H12OS2 — CID 15140623
1-(1,3-dithian-2-yl)prop-2-en-1-ol (PubChem CID 15140623) has the molecular formula C7H12OS2 and a molecular weight of 176.31 g/mol. Its IUPAC name is 1-(1,3-dithian-2-yl)prop-2-en-1-ol.
| Compound Name | 1-(1,3-dithian-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 15140623 |
| Molecular Formula | C7H12OS2 |
| Molecular Weight | 176.31 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | 1-(1,3-dithian-2-yl)prop-2-en-1-ol |
| SMILES | C=CC(O)C1SCCCS1 |
| InChI | InChI=1S/C7H12OS2/c1-2-6(8)7-9-4-3-5-10-7/h2,6-8H,1,3-5H2 |
| InChIKey | KKZQFXHQRZNFNU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|