About 2-ethylbutanoate;3-methoxypropylazanium
2-ethylbutanoate;3-methoxypropylazanium (PubChem CID 142715460) has the molecular formula C10H23NO3
and a molecular weight of 205.30 g/mol. Its IUPAC name is 2-ethylbutanoate;3-methoxypropylazanium.
Molecular Properties
| Compound Name | 2-ethylbutanoate;3-methoxypropylazanium |
| PubChem CID | 142715460 |
| Molecular Formula | C10H23NO3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | 2-ethylbutanoate;3-methoxypropylazanium |
| SMILES | CCC(CC)C(=O)[O-].COCCC[NH3+] |
| InChI | InChI=1S/C6H12O2.C4H11NO/c1-3-5(4-2)6(7)8;1-6-4-2-3-5/h5H,3-4H2,1-2H3,(H,7,8);2-5H2,1H3 |
| InChIKey | KHGOMKJMDBIIFK-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylbutanoate;3-methoxypropylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylbutanoate;3-methoxypropylazanium?
The IUPAC name of 2-ethylbutanoate;3-methoxypropylazanium (CID 142715460) is 2-ethylbutanoate;3-methoxypropylazanium.
What is the SMILES notation for 2-ethylbutanoate;3-methoxypropylazanium?
The canonical SMILES for 2-ethylbutanoate;3-methoxypropylazanium is CCC(CC)C(=O)[O-].COCCC[NH3+].
What is the InChIKey of 2-ethylbutanoate;3-methoxypropylazanium?
The InChIKey is KHGOMKJMDBIIFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C4H11NO/c1-3-5(4-2)6(7)8;1-6-4-2-3-5/h5H,3-4H2,1-2H3,(H,7,8);2-5H2,1H3.
What are the key properties of 2-ethylbutanoate;3-methoxypropylazanium?
2-ethylbutanoate;3-methoxypropylazanium has a molecular weight of 205.30 g/mol, XLogP of -0.56, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylbutanoate;3-methoxypropylazanium is sourced from PubChem (CID 142715460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).