About bis(2-methoxyethylazanium);carbonate
bis(2-methoxyethylazanium);carbonate (PubChem CID 141135297) has the molecular formula C7H20N2O5
and a molecular weight of 212.25 g/mol. Its IUPAC name is bis(2-methoxyethylazanium);carbonate.
Molecular Properties
| Compound Name | bis(2-methoxyethylazanium);carbonate |
| PubChem CID | 141135297 |
| Molecular Formula | C7H20N2O5 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | bis(2-methoxyethylazanium);carbonate |
| SMILES | COCC[NH3+].COCC[NH3+].O=C([O-])[O-] |
| InChI | InChI=1S/2C3H9NO.CH2O3/c2*1-5-3-2-4;2-1(3)4/h2*2-4H2,1H3;(H2,2,3,4) |
| InChIKey | IEOMPGKKSXHZSG-UHFFFAOYSA-N |
| XLogP | -4.70 |
| TPSA | 136.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(2-methoxyethylazanium);carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methoxyethylazanium);carbonate?
The IUPAC name of bis(2-methoxyethylazanium);carbonate (CID 141135297) is bis(2-methoxyethylazanium);carbonate.
What is the SMILES notation for bis(2-methoxyethylazanium);carbonate?
The canonical SMILES for bis(2-methoxyethylazanium);carbonate is COCC[NH3+].COCC[NH3+].O=C([O-])[O-].
What is the InChIKey of bis(2-methoxyethylazanium);carbonate?
The InChIKey is IEOMPGKKSXHZSG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H9NO.CH2O3/c2*1-5-3-2-4;2-1(3)4/h2*2-4H2,1H3;(H2,2,3,4).
What are the key properties of bis(2-methoxyethylazanium);carbonate?
bis(2-methoxyethylazanium);carbonate has a molecular weight of 212.25 g/mol, XLogP of -4.70, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methoxyethylazanium);carbonate is sourced from PubChem (CID 141135297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).