C36H23Br — CID 142716272
10-bromo-2-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-9-(4-phenylphenyl)anthracene (PubChem CID 142716272) has the molecular formula C36H23Br and a molecular weight of 542.53 g/mol. Its IUPAC name is 10-bromo-2-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-9-(4-phenylphenyl)anthracene.
| Compound Name | 10-bromo-2-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-9-(4-phenylphenyl)anthracene |
|---|---|
| PubChem CID | 142716272 |
| Molecular Formula | C36H23Br |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | 10-bromo-2-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-9-(4-phenylphenyl)anthracene |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c(-c3ccc4c(Br)c5ccccc5c(-c5ccc(-c6ccccc6)cc5)c4c3)c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C36H23Br/c37-36-32-13-7-6-12-31(32)35(27-17-14-26(15-18-27)24-8-2-1-3-9-24)34-23-30(20-21-33(34)36)29-19-16-25-10-4-5-11-28(25)22-29/h1-23H/i4D,5D,10D,11D,16D,19D,22D |
| InChIKey | VTRSEIOTEFOILR-HSXZMRCGSA-N |
| XLogP | 10.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|