C11H19NO2 — CID 14271712
4-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-2-one (PubChem CID 14271712) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 4-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-2-one.
| Compound Name | 4-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 14271712 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 4-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-2-one |
| SMILES | CC(C)C1NC(=O)OC2CCCCC21 |
| InChI | InChI=1S/C11H19NO2/c1-7(2)10-8-5-3-4-6-9(8)14-11(13)12-10/h7-10H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | SEHKIHGMYYTWPT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |