About (2-methylcyclohexyl) N-cyclohexylcarbamate
(2-methylcyclohexyl) N-cyclohexylcarbamate (PubChem CID 5128034) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is (2-methylcyclohexyl) N-cyclohexylcarbamate.
Molecular Properties
| Compound Name | (2-methylcyclohexyl) N-cyclohexylcarbamate |
| PubChem CID | 5128034 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | (2-methylcyclohexyl) N-cyclohexylcarbamate |
| SMILES | CC1CCCCC1OC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H25NO2/c1-11-7-5-6-10-13(11)17-14(16)15-12-8-3-2-4-9-12/h11-13H,2-10H2,1H3,(H,15,16) |
| InChIKey | DDSKHAHMBAVXFS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-methylcyclohexyl) N-cyclohexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylcyclohexyl) N-cyclohexylcarbamate?
The IUPAC name of (2-methylcyclohexyl) N-cyclohexylcarbamate (CID 5128034) is (2-methylcyclohexyl) N-cyclohexylcarbamate.
What is the SMILES notation for (2-methylcyclohexyl) N-cyclohexylcarbamate?
The canonical SMILES for (2-methylcyclohexyl) N-cyclohexylcarbamate is CC1CCCCC1OC(=O)NC1CCCCC1.
What is the InChIKey of (2-methylcyclohexyl) N-cyclohexylcarbamate?
The InChIKey is DDSKHAHMBAVXFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO2/c1-11-7-5-6-10-13(11)17-14(16)15-12-8-3-2-4-9-12/h11-13H,2-10H2,1H3,(H,15,16).
What are the key properties of (2-methylcyclohexyl) N-cyclohexylcarbamate?
(2-methylcyclohexyl) N-cyclohexylcarbamate has a molecular weight of 239.36 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclohexyl) N-cyclohexylcarbamate is sourced from PubChem (CID 5128034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).