About 2-propylpentyl N-cyclohexylcarbamate
2-propylpentyl N-cyclohexylcarbamate (PubChem CID 57342031) has the molecular formula C15H29NO2
and a molecular weight of 255.40 g/mol. Its IUPAC name is 2-propylpentyl N-cyclohexylcarbamate.
Molecular Properties
| Compound Name | 2-propylpentyl N-cyclohexylcarbamate |
| PubChem CID | 57342031 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 2-propylpentyl N-cyclohexylcarbamate |
| SMILES | CCCC(CCC)COC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C15H29NO2/c1-3-8-13(9-4-2)12-18-15(17)16-14-10-6-5-7-11-14/h13-14H,3-12H2,1-2H3,(H,16,17) |
| InChIKey | VPAKUNRMHOCQAH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propylpentyl N-cyclohexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylpentyl N-cyclohexylcarbamate?
The IUPAC name of 2-propylpentyl N-cyclohexylcarbamate (CID 57342031) is 2-propylpentyl N-cyclohexylcarbamate.
What is the SMILES notation for 2-propylpentyl N-cyclohexylcarbamate?
The canonical SMILES for 2-propylpentyl N-cyclohexylcarbamate is CCCC(CCC)COC(=O)NC1CCCCC1.
What is the InChIKey of 2-propylpentyl N-cyclohexylcarbamate?
The InChIKey is VPAKUNRMHOCQAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO2/c1-3-8-13(9-4-2)12-18-15(17)16-14-10-6-5-7-11-14/h13-14H,3-12H2,1-2H3,(H,16,17).
What are the key properties of 2-propylpentyl N-cyclohexylcarbamate?
2-propylpentyl N-cyclohexylcarbamate has a molecular weight of 255.40 g/mol, XLogP of 4.26, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylpentyl N-cyclohexylcarbamate is sourced from PubChem (CID 57342031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).