About 4-cyclohexylbutyl N-cyclohexylcarbamate
4-cyclohexylbutyl N-cyclohexylcarbamate (PubChem CID 22978793) has the molecular formula C17H31NO2
and a molecular weight of 281.44 g/mol. Its IUPAC name is 4-cyclohexylbutyl N-cyclohexylcarbamate.
Molecular Properties
| Compound Name | 4-cyclohexylbutyl N-cyclohexylcarbamate |
| PubChem CID | 22978793 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | 4-cyclohexylbutyl N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)OCCCCC1CCCCC1 |
| InChI | InChI=1S/C17H31NO2/c19-17(18-16-12-5-2-6-13-16)20-14-8-7-11-15-9-3-1-4-10-15/h15-16H,1-14H2,(H,18,19) |
| InChIKey | MLWZPBFHICOPQN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexylbutyl N-cyclohexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylbutyl N-cyclohexylcarbamate?
The IUPAC name of 4-cyclohexylbutyl N-cyclohexylcarbamate (CID 22978793) is 4-cyclohexylbutyl N-cyclohexylcarbamate.
What is the SMILES notation for 4-cyclohexylbutyl N-cyclohexylcarbamate?
The canonical SMILES for 4-cyclohexylbutyl N-cyclohexylcarbamate is O=C(NC1CCCCC1)OCCCCC1CCCCC1.
What is the InChIKey of 4-cyclohexylbutyl N-cyclohexylcarbamate?
The InChIKey is MLWZPBFHICOPQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31NO2/c19-17(18-16-12-5-2-6-13-16)20-14-8-7-11-15-9-3-1-4-10-15/h15-16H,1-14H2,(H,18,19).
What are the key properties of 4-cyclohexylbutyl N-cyclohexylcarbamate?
4-cyclohexylbutyl N-cyclohexylcarbamate has a molecular weight of 281.44 g/mol, XLogP of 4.80, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylbutyl N-cyclohexylcarbamate is sourced from PubChem (CID 22978793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).