About 2-ethylhexyl N-heptan-2-ylcarbamate
2-ethylhexyl N-heptan-2-ylcarbamate (PubChem CID 91692978) has the molecular formula C16H33NO2
and a molecular weight of 271.44 g/mol. Its IUPAC name is 2-ethylhexyl N-heptan-2-ylcarbamate.
Molecular Properties
| Compound Name | 2-ethylhexyl N-heptan-2-ylcarbamate |
| PubChem CID | 91692978 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | 2-ethylhexyl N-heptan-2-ylcarbamate |
| SMILES | CCCCCC(C)NC(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C16H33NO2/c1-5-8-10-11-14(4)17-16(18)19-13-15(7-3)12-9-6-2/h14-15H,5-13H2,1-4H3,(H,17,18) |
| InChIKey | JKNXFYPSRJLSMF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexyl N-heptan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl N-heptan-2-ylcarbamate?
The IUPAC name of 2-ethylhexyl N-heptan-2-ylcarbamate (CID 91692978) is 2-ethylhexyl N-heptan-2-ylcarbamate.
What is the SMILES notation for 2-ethylhexyl N-heptan-2-ylcarbamate?
The canonical SMILES for 2-ethylhexyl N-heptan-2-ylcarbamate is CCCCCC(C)NC(=O)OCC(CC)CCCC.
What is the InChIKey of 2-ethylhexyl N-heptan-2-ylcarbamate?
The InChIKey is JKNXFYPSRJLSMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO2/c1-5-8-10-11-14(4)17-16(18)19-13-15(7-3)12-9-6-2/h14-15H,5-13H2,1-4H3,(H,17,18).
What are the key properties of 2-ethylhexyl N-heptan-2-ylcarbamate?
2-ethylhexyl N-heptan-2-ylcarbamate has a molecular weight of 271.44 g/mol, XLogP of 4.90, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl N-heptan-2-ylcarbamate is sourced from PubChem (CID 91692978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).