C26H33ClN4O3SSi — CID 142717330
N-[[1-[(E)-3-(4-chlorophenyl)-1-cyanopent-1-en-3-yl]indazol-4-yl]-(2-trimethylsilylethoxy)methyl]methanesulfonamide (PubChem CID 142717330) has the molecular formula C26H33ClN4O3SSi and a molecular weight of 545.18 g/mol. Its IUPAC name is N-[[1-[(E)-3-(4-chlorophenyl)-1-cyanopent-1-en-3-yl]indazol-4-yl]-(2-trimethylsilylethoxy)methyl]methanesulfonamide.
| Compound Name | N-[[1-[(E)-3-(4-chlorophenyl)-1-cyanopent-1-en-3-yl]indazol-4-yl]-(2-trimethylsilylethoxy)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 142717330 |
| Molecular Formula | C26H33ClN4O3SSi |
| Molecular Weight | 545.18 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | N-[[1-[(E)-3-(4-chlorophenyl)-1-cyanopent-1-en-3-yl]indazol-4-yl]-(2-trimethylsilylethoxy)methyl]methanesulfonamide |
| SMILES | CCC(/C=C/C#N)(c1ccc(Cl)cc1)n1ncc2c(C(NS(C)(=O)=O)OCC[Si](C)(C)C)cccc21 |
| InChI | InChI=1S/C26H33ClN4O3SSi/c1-6-26(15-8-16-28,20-11-13-21(27)14-12-20)31-24-10-7-9-22(23(24)19-29-31)25(30-35(2,32)33)34-17-18-36(3,4)5/h7-15,19,25,30H,6,17-18H2,1-5H3/b15-8+ |
| InChIKey | CLMPSWSUGSFIHU-OVCLIPMQSA-N |
| XLogP | 5.83 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.18 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|