C24H34ClN3O4SSi — CID 140624966
N-[[1-[2-(4-chlorophenyl)-1-hydroxybutan-2-yl]indazol-4-yl]-(2-trimethylsilylethoxy)methyl]methanesulfonamide (PubChem CID 140624966) has the molecular formula C24H34ClN3O4SSi and a molecular weight of 524.16 g/mol. Its IUPAC name is N-[[1-[2-(4-chlorophenyl)-1-hydroxybutan-2-yl]indazol-4-yl]-(2-trimethylsilylethoxy)methyl]methanesulfonamide.
| Compound Name | N-[[1-[2-(4-chlorophenyl)-1-hydroxybutan-2-yl]indazol-4-yl]-(2-trimethylsilylethoxy)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 140624966 |
| Molecular Formula | C24H34ClN3O4SSi |
| Molecular Weight | 524.16 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | N-[[1-[2-(4-chlorophenyl)-1-hydroxybutan-2-yl]indazol-4-yl]-(2-trimethylsilylethoxy)methyl]methanesulfonamide |
| SMILES | CCC(CO)(c1ccc(Cl)cc1)n1ncc2c(C(NS(C)(=O)=O)OCC[Si](C)(C)C)cccc21 |
| InChI | InChI=1S/C24H34ClN3O4SSi/c1-6-24(17-29,18-10-12-19(25)13-11-18)28-22-9-7-8-20(21(22)16-26-28)23(27-33(2,30)31)32-14-15-34(3,4)5/h7-13,16,23,27,29H,6,14-15,17H2,1-5H3 |
| InChIKey | RWSJYXJEUJMAHM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.16 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|