C28H27N3O5 — CID 142720088
N-(5-cyano-2-pyridinyl)-3-[2-[3-(2-methoxyethoxy)phenyl]ethynyl]-5-[(2S)-1-methoxypropan-2-yl]oxybenzamide (PubChem CID 142720088) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is N-(5-cyano-2-pyridinyl)-3-[2-[3-(2-methoxyethoxy)phenyl]ethynyl]-5-[(2S)-1-methoxypropan-2-yl]oxybenzamide.
| Compound Name | N-(5-cyano-2-pyridinyl)-3-[2-[3-(2-methoxyethoxy)phenyl]ethynyl]-5-[(2S)-1-methoxypropan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 142720088 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-(5-cyano-2-pyridinyl)-3-[2-[3-(2-methoxyethoxy)phenyl]ethynyl]-5-[(2S)-1-methoxypropan-2-yl]oxybenzamide |
| SMILES | COCCOc1cccc(C#Cc2cc(O[C@@H](C)COC)cc(C(=O)Nc3ccc(C#N)cn3)c2)c1 |
| InChI | InChI=1S/C28H27N3O5/c1-20(19-34-3)36-26-15-22(8-7-21-5-4-6-25(14-21)35-12-11-33-2)13-24(16-26)28(32)31-27-10-9-23(17-29)18-30-27/h4-6,9-10,13-16,18,20H,11-12,19H2,1-3H3,(H,30,31,32)/t20-/m0/s1 |
| InChIKey | PYMXZBFUPZAMMB-FQEVSTJZSA-N |
| XLogP | 4.04 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|