C18H15N3 — CID 142724944
2-(9,9-dimethylfluoren-3-yl)-1,3,5-triazine (PubChem CID 142724944) has the molecular formula C18H15N3 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-(9,9-dimethylfluoren-3-yl)-1,3,5-triazine.
| Compound Name | 2-(9,9-dimethylfluoren-3-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 142724944 |
| Molecular Formula | C18H15N3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-(9,9-dimethylfluoren-3-yl)-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2cc(-c3ncncn3)ccc21 |
| InChI | InChI=1S/C18H15N3/c1-18(2)15-6-4-3-5-13(15)14-9-12(7-8-16(14)18)17-20-10-19-11-21-17/h3-11H,1-2H3 |
| InChIKey | LPSDLCUJESVDAC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |