C46H50O8 — CID 142725662
diethyl 4-[10-[3,4-bis(ethoxycarbonyl)phenyl]-2,6-ditert-butylanthracen-9-yl]benzene-1,2-dicarboxylate (PubChem CID 142725662) has the molecular formula C46H50O8 and a molecular weight of 730.90 g/mol. Its IUPAC name is diethyl 4-[10-[3,4-bis(ethoxycarbonyl)phenyl]-2,6-ditert-butylanthracen-9-yl]benzene-1,2-dicarboxylate.
| Compound Name | diethyl 4-[10-[3,4-bis(ethoxycarbonyl)phenyl]-2,6-ditert-butylanthracen-9-yl]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 142725662 |
| Molecular Formula | C46H50O8 |
| Molecular Weight | 730.90 g/mol |
| Exact Mass | 730.35 |
| IUPAC Name | diethyl 4-[10-[3,4-bis(ethoxycarbonyl)phenyl]-2,6-ditert-butylanthracen-9-yl]benzene-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1ccc(-c2c3ccc(C(C)(C)C)cc3c(-c3ccc(C(=O)OCC)c(C(=O)OCC)c3)c3ccc(C(C)(C)C)cc23)cc1C(=O)OCC |
| InChI | InChI=1S/C46H50O8/c1-11-51-41(47)33-19-15-27(23-37(33)43(49)53-13-3)39-31-21-17-30(46(8,9)10)26-36(31)40(32-22-18-29(25-35(32)39)45(5,6)7)28-16-20-34(42(48)52-12-2)38(24-28)44(50)54-14-4/h15-26H,11-14H2,1-10H3 |
| InChIKey | GSNMLASEQMVYOG-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.90 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|