C6H4ClIN2 — CID 142726040
4-chloro-9λ3-ioda-1,7-diazabicyclo[4.3.0]nona-2,4,6,8-tetraene (PubChem CID 142726040) has the molecular formula C6H4ClIN2 and a molecular weight of 266.47 g/mol. Its IUPAC name is 4-chloro-9λ3-ioda-1,7-diazabicyclo[4.3.0]nona-2,4,6,8-tetraene.
| Compound Name | 4-chloro-9λ3-ioda-1,7-diazabicyclo[4.3.0]nona-2,4,6,8-tetraene |
|---|---|
| PubChem CID | 142726040 |
| Molecular Formula | C6H4ClIN2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 265.91 |
| IUPAC Name | 4-chloro-9λ3-ioda-1,7-diazabicyclo[4.3.0]nona-2,4,6,8-tetraene |
| SMILES | ClC1=CC2=NC=IN2C=C1 |
| InChI | InChI=1S/C6H4ClIN2/c7-5-1-2-10-6(3-5)9-4-8-10/h1-4H |
| InChIKey | UCZIQPRBAAWQKK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|