C22H18ClFN4O — CID 142726238
1-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylmethanamine (PubChem CID 142726238) has the molecular formula C22H18ClFN4O and a molecular weight of 408.86 g/mol. Its IUPAC name is 1-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylmethanamine.
| Compound Name | 1-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 142726238 |
| Molecular Formula | C22H18ClFN4O |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 1-[6-[2-(3-chloro-4-fluorophenyl)-3-pyridinyl]quinazolin-4-yl]oxy-N,N-dimethylmethanamine |
| SMILES | CN(C)COc1ncnc2ccc(-c3cccnc3-c3ccc(F)c(Cl)c3)cc12 |
| InChI | InChI=1S/C22H18ClFN4O/c1-28(2)13-29-22-17-10-14(6-8-20(17)26-12-27-22)16-4-3-9-25-21(16)15-5-7-19(24)18(23)11-15/h3-12H,13H2,1-2H3 |
| InChIKey | KFRYZFPFNCOGOC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|