C25H21NO7 — CID 142727288
N-[3-(5-hydroxy-6,7-dimethoxy-4-oxochromen-2-yl)phenyl]-2-methoxybenzamide (PubChem CID 142727288) has the molecular formula C25H21NO7 and a molecular weight of 447.44 g/mol. Its IUPAC name is N-[3-(5-hydroxy-6,7-dimethoxy-4-oxochromen-2-yl)phenyl]-2-methoxybenzamide.
| Compound Name | N-[3-(5-hydroxy-6,7-dimethoxy-4-oxochromen-2-yl)phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 142727288 |
| Molecular Formula | C25H21NO7 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-[3-(5-hydroxy-6,7-dimethoxy-4-oxochromen-2-yl)phenyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1cccc(-c2cc(=O)c3c(O)c(OC)c(OC)cc3o2)c1 |
| InChI | InChI=1S/C25H21NO7/c1-30-18-10-5-4-9-16(18)25(29)26-15-8-6-7-14(11-15)19-12-17(27)22-20(33-19)13-21(31-2)24(32-3)23(22)28/h4-13,28H,1-3H3,(H,26,29) |
| InChIKey | ZZVWZUDVCVWWAO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |