C18H13NO5 — CID 25017511
9-hydroxy-10-methoxy-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione (PubChem CID 25017511) has the molecular formula C18H13NO5 and a molecular weight of 323.30 g/mol. Its IUPAC name is 9-hydroxy-10-methoxy-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione.
| Compound Name | 9-hydroxy-10-methoxy-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione |
|---|---|
| PubChem CID | 25017511 |
| Molecular Formula | C18H13NO5 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 9-hydroxy-10-methoxy-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione |
| SMILES | COc1c(O)ccc2oc(=O)c3c(ccc4[nH]c(=O)cc(C)c43)c12 |
| InChI | InChI=1S/C18H13NO5/c1-8-7-13(21)19-10-4-3-9-15-12(6-5-11(20)17(15)23-2)24-18(22)16(9)14(8)10/h3-7,20H,1-2H3,(H,19,21) |
| InChIKey | SNCFYIQVKBGNRO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|