C20H17NO5 — CID 25017761
9-ethoxy-10-methoxy-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione (PubChem CID 25017761) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is 9-ethoxy-10-methoxy-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione.
| Compound Name | 9-ethoxy-10-methoxy-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione |
|---|---|
| PubChem CID | 25017761 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 9-ethoxy-10-methoxy-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione |
| SMILES | CCOc1ccc2oc(=O)c3c(ccc4[nH]c(=O)cc(C)c43)c2c1OC |
| InChI | InChI=1S/C20H17NO5/c1-4-25-14-8-7-13-17(19(14)24-3)11-5-6-12-16(18(11)20(23)26-13)10(2)9-15(22)21-12/h5-9H,4H2,1-3H3,(H,21,22) |
| InChIKey | SFCIXTYEKOUYAT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 81.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|