C16H30O3 — CID 142729927
2-methylpropyl 4-oxo-2,3-di(propan-2-yl)hexanoate (PubChem CID 142729927) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is 2-methylpropyl 4-oxo-2,3-di(propan-2-yl)hexanoate.
| Compound Name | 2-methylpropyl 4-oxo-2,3-di(propan-2-yl)hexanoate |
|---|---|
| PubChem CID | 142729927 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 2-methylpropyl 4-oxo-2,3-di(propan-2-yl)hexanoate |
| SMILES | CCC(=O)C(C(C)C)C(C(=O)OCC(C)C)C(C)C |
| InChI | InChI=1S/C16H30O3/c1-8-13(17)14(11(4)5)15(12(6)7)16(18)19-9-10(2)3/h10-12,14-15H,8-9H2,1-7H3 |
| InChIKey | KALTVTHIEBCTSJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |