C17H13NO6 — CID 142731399
1,3-dimethyl-2-nitrofluorene-9,9-dicarboxylic acid (PubChem CID 142731399) has the molecular formula C17H13NO6 and a molecular weight of 327.29 g/mol. Its IUPAC name is 1,3-dimethyl-2-nitrofluorene-9,9-dicarboxylic acid.
| Compound Name | 1,3-dimethyl-2-nitrofluorene-9,9-dicarboxylic acid |
|---|---|
| PubChem CID | 142731399 |
| Molecular Formula | C17H13NO6 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 1,3-dimethyl-2-nitrofluorene-9,9-dicarboxylic acid |
| SMILES | Cc1cc2c(c(C)c1[N+](=O)[O-])C(C(=O)O)(C(=O)O)c1ccccc1-2 |
| InChI | InChI=1S/C17H13NO6/c1-8-7-11-10-5-3-4-6-12(10)17(15(19)20,16(21)22)13(11)9(2)14(8)18(23)24/h3-7H,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | XNQQVRIDSLQHBQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|