C19H17NO6 — CID 142731389
1,3-diethyl-2-nitrofluorene-9,9-dicarboxylic acid (PubChem CID 142731389) has the molecular formula C19H17NO6 and a molecular weight of 355.35 g/mol. Its IUPAC name is 1,3-diethyl-2-nitrofluorene-9,9-dicarboxylic acid.
| Compound Name | 1,3-diethyl-2-nitrofluorene-9,9-dicarboxylic acid |
|---|---|
| PubChem CID | 142731389 |
| Molecular Formula | C19H17NO6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1,3-diethyl-2-nitrofluorene-9,9-dicarboxylic acid |
| SMILES | CCc1cc2c(c(CC)c1[N+](=O)[O-])C(C(=O)O)(C(=O)O)c1ccccc1-2 |
| InChI | InChI=1S/C19H17NO6/c1-3-10-9-13-12-7-5-6-8-14(12)19(17(21)22,18(23)24)15(13)11(4-2)16(10)20(25)26/h5-9H,3-4H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | KGSUZNRSUBSYMV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|