C27H28Cl2N4O2S — CID 142734315
2-[3,4-dichloro-N-(cyanomethyl)anilino]-N-methyl-N-[2-morpholin-4-yl-1-(4-thiophen-3-ylphenyl)ethyl]acetamide (PubChem CID 142734315) has the molecular formula C27H28Cl2N4O2S and a molecular weight of 543.52 g/mol. Its IUPAC name is 2-[3,4-dichloro-N-(cyanomethyl)anilino]-N-methyl-N-[2-morpholin-4-yl-1-(4-thiophen-3-ylphenyl)ethyl]acetamide.
| Compound Name | 2-[3,4-dichloro-N-(cyanomethyl)anilino]-N-methyl-N-[2-morpholin-4-yl-1-(4-thiophen-3-ylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 142734315 |
| Molecular Formula | C27H28Cl2N4O2S |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | 2-[3,4-dichloro-N-(cyanomethyl)anilino]-N-methyl-N-[2-morpholin-4-yl-1-(4-thiophen-3-ylphenyl)ethyl]acetamide |
| SMILES | CN(C(=O)CN(CC#N)c1ccc(Cl)c(Cl)c1)C(CN1CCOCC1)c1ccc(-c2ccsc2)cc1 |
| InChI | InChI=1S/C27H28Cl2N4O2S/c1-31(27(34)18-33(10-9-30)23-6-7-24(28)25(29)16-23)26(17-32-11-13-35-14-12-32)21-4-2-20(3-5-21)22-8-15-36-19-22/h2-8,15-16,19,26H,10-14,17-18H2,1H3 |
| InChIKey | WQMVGPMDBPKTOH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 59.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|