C30H31Cl2N5O3 — CID 87481391
4-[4-[1-[[3-[3,4-dichloro-N-(cyanomethyl)anilino]-2-oxopropyl]amino]-2-morpholin-4-ylethyl]phenyl]benzamide (PubChem CID 87481391) has the molecular formula C30H31Cl2N5O3 and a molecular weight of 580.52 g/mol. Its IUPAC name is 4-[4-[1-[[3-[3,4-dichloro-N-(cyanomethyl)anilino]-2-oxopropyl]amino]-2-morpholin-4-ylethyl]phenyl]benzamide.
| Compound Name | 4-[4-[1-[[3-[3,4-dichloro-N-(cyanomethyl)anilino]-2-oxopropyl]amino]-2-morpholin-4-ylethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 87481391 |
| Molecular Formula | C30H31Cl2N5O3 |
| Molecular Weight | 580.52 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | 4-[4-[1-[[3-[3,4-dichloro-N-(cyanomethyl)anilino]-2-oxopropyl]amino]-2-morpholin-4-ylethyl]phenyl]benzamide |
| SMILES | N#CCN(CC(=O)CNC(CN1CCOCC1)c1ccc(-c2ccc(C(N)=O)cc2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C30H31Cl2N5O3/c31-27-10-9-25(17-28(27)32)37(12-11-33)19-26(38)18-35-29(20-36-13-15-40-16-14-36)23-5-1-21(2-6-23)22-3-7-24(8-4-22)30(34)39/h1-10,17,29,35H,12-16,18-20H2,(H2,34,39) |
| InChIKey | BEZRUNICLPULNV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 111.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|