C30H31Cl2N5O3 — CID 57488883
2-[4-[1-[[2-[3,4-dichloro-N-(cyanomethyl)anilino]acetyl]-methylamino]-2-morpholin-4-ylethyl]phenyl]benzamide (PubChem CID 57488883) has the molecular formula C30H31Cl2N5O3 and a molecular weight of 580.52 g/mol. Its IUPAC name is 2-[4-[1-[[2-[3,4-dichloro-N-(cyanomethyl)anilino]acetyl]-methylamino]-2-morpholin-4-ylethyl]phenyl]benzamide.
| Compound Name | 2-[4-[1-[[2-[3,4-dichloro-N-(cyanomethyl)anilino]acetyl]-methylamino]-2-morpholin-4-ylethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 57488883 |
| Molecular Formula | C30H31Cl2N5O3 |
| Molecular Weight | 580.52 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | 2-[4-[1-[[2-[3,4-dichloro-N-(cyanomethyl)anilino]acetyl]-methylamino]-2-morpholin-4-ylethyl]phenyl]benzamide |
| SMILES | CN(C(=O)CN(CC#N)c1ccc(Cl)c(Cl)c1)C(CN1CCOCC1)c1ccc(-c2ccccc2C(N)=O)cc1 |
| InChI | InChI=1S/C30H31Cl2N5O3/c1-35(29(38)20-37(13-12-33)23-10-11-26(31)27(32)18-23)28(19-36-14-16-40-17-15-36)22-8-6-21(7-9-22)24-4-2-3-5-25(24)30(34)39/h2-11,18,28H,13-17,19-20H2,1H3,(H2,34,39) |
| InChIKey | ZPVIYVOOLCNTOF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|