C25H25NO10S — CID 142734651
methyl (Z)-3-[4-(4-methyl-2-oxochromen-7-yl)oxysulfonyloxyphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoate (PubChem CID 142734651) has the molecular formula C25H25NO10S and a molecular weight of 531.54 g/mol. Its IUPAC name is methyl (Z)-3-[4-(4-methyl-2-oxochromen-7-yl)oxysulfonyloxyphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoate.
| Compound Name | methyl (Z)-3-[4-(4-methyl-2-oxochromen-7-yl)oxysulfonyloxyphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoate |
|---|---|
| PubChem CID | 142734651 |
| Molecular Formula | C25H25NO10S |
| Molecular Weight | 531.54 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | methyl (Z)-3-[4-(4-methyl-2-oxochromen-7-yl)oxysulfonyloxyphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1ccc(OS(=O)(=O)Oc2ccc3c(C)cc(=O)oc3c2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H25NO10S/c1-15-12-22(27)33-21-14-18(10-11-19(15)21)36-37(30,31)35-17-8-6-16(7-9-17)13-20(23(28)32-5)26-24(29)34-25(2,3)4/h6-14H,1-5H3,(H,26,29)/b20-13- |
| InChIKey | WLFHFKMEAYGCRW-MOSHPQCFSA-N |
| XLogP | 3.84 |
| TPSA | 147.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|