C22H35N2O4+ — CID 1427369
ethyl 4-[[(3R,3aS,5S,8aS,9aS)-5,8a-dimethyl-2-oxo-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl]methyl]piperazin-4-ium-1-carboxylate (PubChem CID 1427369) has the molecular formula C22H35N2O4+ and a molecular weight of 391.53 g/mol. Its IUPAC name is ethyl 4-[[(3R,3aS,5S,8aS,9aS)-5,8a-dimethyl-2-oxo-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl]methyl]piperazin-4-ium-1-carboxylate.
| Compound Name | ethyl 4-[[(3R,3aS,5S,8aS,9aS)-5,8a-dimethyl-2-oxo-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl]methyl]piperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 1427369 |
| Molecular Formula | C22H35N2O4+ |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | ethyl 4-[[(3R,3aS,5S,8aS,9aS)-5,8a-dimethyl-2-oxo-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl]methyl]piperazin-4-ium-1-carboxylate |
| SMILES | CCOC(=O)N1CC[NH+](C[C@@H]2C(=O)O[C@H]3C[C@]4(C)CCC[C@H](C)C4=C[C@H]32)CC1 |
| InChI | InChI=1S/C22H34N2O4/c1-4-27-21(26)24-10-8-23(9-11-24)14-17-16-12-18-15(2)6-5-7-22(18,3)13-19(16)28-20(17)25/h12,15-17,19H,4-11,13-14H2,1-3H3/p+1/t15-,16-,17-,19-,22-/m0/s1 |
| InChIKey | NGNDKPBQSHRIRV-PTZHDYIFSA-O |
| XLogP | 1.66 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|