C28H37ClN2O6 — CID 44661544
3-[[4-(5-chloro-2-methylphenyl)piperazin-1-ium-1-yl]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one;2-hydroxy-2-oxoacetate (PubChem CID 44661544) has the molecular formula C28H37ClN2O6 and a molecular weight of 533.07 g/mol. Its IUPAC name is 3-[[4-(5-chloro-2-methylphenyl)piperazin-1-ium-1-yl]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one;2-hydroxy-2-oxoacetate.
| Compound Name | 3-[[4-(5-chloro-2-methylphenyl)piperazin-1-ium-1-yl]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 44661544 |
| Molecular Formula | C28H37ClN2O6 |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 3-[[4-(5-chloro-2-methylphenyl)piperazin-1-ium-1-yl]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one;2-hydroxy-2-oxoacetate |
| SMILES | Cc1ccc(Cl)cc1N1CC[NH+](CC2C(=O)OC3CC4(C)CCCC(C)C4=CC32)CC1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C26H35ClN2O2.C2H2O4/c1-17-5-4-8-26(3)15-24-20(14-22(17)26)21(25(30)31-24)16-28-9-11-29(12-10-28)23-13-19(27)7-6-18(23)2;3-1(4)2(5)6/h6-7,13-14,17,20-21,24H,4-5,8-12,15-16H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | AFEXSPSOEKIKMB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|