C22H29ClO6S — CID 142736954
dibutyl 4-(benzenesulfonyl)-5-chlorocyclohex-4-ene-1,2-dicarboxylate (PubChem CID 142736954) has the molecular formula C22H29ClO6S and a molecular weight of 456.99 g/mol. Its IUPAC name is dibutyl 4-(benzenesulfonyl)-5-chlorocyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | dibutyl 4-(benzenesulfonyl)-5-chlorocyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 142736954 |
| Molecular Formula | C22H29ClO6S |
| Molecular Weight | 456.99 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | dibutyl 4-(benzenesulfonyl)-5-chlorocyclohex-4-ene-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)C1CC(Cl)=C(S(=O)(=O)c2ccccc2)CC1C(=O)OCCCC |
| InChI | InChI=1S/C22H29ClO6S/c1-3-5-12-28-21(24)17-14-19(23)20(15-18(17)22(25)29-13-6-4-2)30(26,27)16-10-8-7-9-11-16/h7-11,17-18H,3-6,12-15H2,1-2H3 |
| InChIKey | ABGFCMDRLDUQRL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.99 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|