C25H26N4O6Se — CID 142736984
5-[[6-[6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-pyridinyl]pyrimidin-4-yl]amino]-1-benzoselenophene-2-carboxylic acid (PubChem CID 142736984) has the molecular formula C25H26N4O6Se and a molecular weight of 557.47 g/mol. Its IUPAC name is 5-[[6-[6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-pyridinyl]pyrimidin-4-yl]amino]-1-benzoselenophene-2-carboxylic acid.
| Compound Name | 5-[[6-[6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-pyridinyl]pyrimidin-4-yl]amino]-1-benzoselenophene-2-carboxylic acid |
|---|---|
| PubChem CID | 142736984 |
| Molecular Formula | C25H26N4O6Se |
| Molecular Weight | 557.47 g/mol |
| Exact Mass | 558.10 |
| IUPAC Name | 5-[[6-[6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-pyridinyl]pyrimidin-4-yl]amino]-1-benzoselenophene-2-carboxylic acid |
| SMILES | COCCOCCOCCOc1ccc(-c2cc(Nc3ccc4[se]c(C(=O)O)cc4c3)ncn2)cn1 |
| InChI | InChI=1S/C25H26N4O6Se/c1-32-6-7-33-8-9-34-10-11-35-24-5-2-17(15-26-24)20-14-23(28-16-27-20)29-19-3-4-21-18(12-19)13-22(36-21)25(30)31/h2-5,12-16H,6-11H2,1H3,(H,30,31)(H,27,28,29) |
| InChIKey | BLMPJECCHKRCPL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|