C15H12ClN3O2Se — CID 142736982
ethyl 5-[(6-chloropyrimidin-4-yl)amino]-1-benzoselenophene-2-carboxylate (PubChem CID 142736982) has the molecular formula C15H12ClN3O2Se and a molecular weight of 380.69 g/mol. Its IUPAC name is ethyl 5-[(6-chloropyrimidin-4-yl)amino]-1-benzoselenophene-2-carboxylate.
| Compound Name | ethyl 5-[(6-chloropyrimidin-4-yl)amino]-1-benzoselenophene-2-carboxylate |
|---|---|
| PubChem CID | 142736982 |
| Molecular Formula | C15H12ClN3O2Se |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | ethyl 5-[(6-chloropyrimidin-4-yl)amino]-1-benzoselenophene-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(Nc3cc(Cl)ncn3)ccc2[se]1 |
| InChI | InChI=1S/C15H12ClN3O2Se/c1-2-21-15(20)12-6-9-5-10(3-4-11(9)22-12)19-14-7-13(16)17-8-18-14/h3-8H,2H2,1H3,(H,17,18,19) |
| InChIKey | MXDUIGMJLIYHAU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|