C15H11Cl2N3O2Se — CID 142737007
ethyl 5-[(2,6-dichloropyrimidin-4-yl)amino]-1-benzoselenophene-2-carboxylate (PubChem CID 142737007) has the molecular formula C15H11Cl2N3O2Se and a molecular weight of 415.14 g/mol. Its IUPAC name is ethyl 5-[(2,6-dichloropyrimidin-4-yl)amino]-1-benzoselenophene-2-carboxylate.
| Compound Name | ethyl 5-[(2,6-dichloropyrimidin-4-yl)amino]-1-benzoselenophene-2-carboxylate |
|---|---|
| PubChem CID | 142737007 |
| Molecular Formula | C15H11Cl2N3O2Se |
| Molecular Weight | 415.14 g/mol |
| Exact Mass | 414.94 |
| IUPAC Name | ethyl 5-[(2,6-dichloropyrimidin-4-yl)amino]-1-benzoselenophene-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(Nc3cc(Cl)nc(Cl)n3)ccc2[se]1 |
| InChI | InChI=1S/C15H11Cl2N3O2Se/c1-2-22-14(21)11-6-8-5-9(3-4-10(8)23-11)18-13-7-12(16)19-15(17)20-13/h3-7H,2H2,1H3,(H,18,19,20) |
| InChIKey | LFKDVUFHEJEYEO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.14 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|