C17H16N4O3Se — CID 142736991
5-[(6-morpholin-4-ylpyrimidin-4-yl)amino]-1-benzoselenophene-2-carboxylic acid (PubChem CID 142736991) has the molecular formula C17H16N4O3Se and a molecular weight of 403.30 g/mol. Its IUPAC name is 5-[(6-morpholin-4-ylpyrimidin-4-yl)amino]-1-benzoselenophene-2-carboxylic acid.
| Compound Name | 5-[(6-morpholin-4-ylpyrimidin-4-yl)amino]-1-benzoselenophene-2-carboxylic acid |
|---|---|
| PubChem CID | 142736991 |
| Molecular Formula | C17H16N4O3Se |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 5-[(6-morpholin-4-ylpyrimidin-4-yl)amino]-1-benzoselenophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(Nc3cc(N4CCOCC4)ncn3)ccc2[se]1 |
| InChI | InChI=1S/C17H16N4O3Se/c22-17(23)14-8-11-7-12(1-2-13(11)25-14)20-15-9-16(19-10-18-15)21-3-5-24-6-4-21/h1-2,7-10H,3-6H2,(H,22,23)(H,18,19,20) |
| InChIKey | FCUUAEKKFXLYNH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|