C14H15NO5 — CID 142737203
methyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate (PubChem CID 142737203) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is methyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate.
| Compound Name | methyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 142737203 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | methyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(=O)c2c(OC)ccc(OC)c2n1C |
| InChI | InChI=1S/C14H15NO5/c1-15-8(14(17)20-4)7-9(16)12-10(18-2)5-6-11(19-3)13(12)15/h5-7H,1-4H3 |
| InChIKey | FAAWHKCBHCKFJB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |