methyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate

C14H15NO5 — CID 142737203

IUPACmethyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate
SMILESCOC(=O)c1cc(=O)c2c(OC)ccc(OC)c2n1C
InChIInChI=1S/C14H15NO5/c1-15-8(14(17)20-4)7-9(16)12-10(18-2)5-6-11(19-3)13(12)15/h5-7H,1-4H3
InChIKeyFAAWHKCBHCKFJB-UHFFFAOYSA-N
MW277.28 g/mol
LogP1.34
Rot. Bonds3

About methyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate

methyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate (PubChem CID 142737203) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is methyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate.

Molecular Properties

Compound Namemethyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate
PubChem CID142737203
Molecular FormulaC14H15NO5
Molecular Weight277.28 g/mol
Exact Mass277.10
IUPAC Namemethyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate
SMILESCOC(=O)c1cc(=O)c2c(OC)ccc(OC)c2n1C
InChIInChI=1S/C14H15NO5/c1-15-8(14(17)20-4)7-9(16)12-10(18-2)5-6-11(19-3)13(12)15/h5-7H,1-4H3
InChIKeyFAAWHKCBHCKFJB-UHFFFAOYSA-N
XLogP1.34
TPSA66.76 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.28
LogP ≤ 51.34
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate?
The IUPAC name of methyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate (CID 142737203) is methyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate.
What is the SMILES notation for methyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate?
The canonical SMILES for methyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate is COC(=O)c1cc(=O)c2c(OC)ccc(OC)c2n1C.
What is the InChIKey of methyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate?
The InChIKey is FAAWHKCBHCKFJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO5/c1-15-8(14(17)20-4)7-9(16)12-10(18-2)5-6-11(19-3)13(12)15/h5-7H,1-4H3.
What are the key properties of methyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate?
methyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate has a molecular weight of 277.28 g/mol, XLogP of 1.34, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5,8-dimethoxy-1-methyl-4-oxoquinoline-2-carboxylate is sourced from PubChem (CID 142737203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).