C13H12ClNO5 — CID 82251962
5-chloro-1-(2-hydroxyethyl)-8-methoxy-4-oxoquinoline-2-carboxylic acid (PubChem CID 82251962) has the molecular formula C13H12ClNO5 and a molecular weight of 297.69 g/mol. Its IUPAC name is 5-chloro-1-(2-hydroxyethyl)-8-methoxy-4-oxoquinoline-2-carboxylic acid.
| Compound Name | 5-chloro-1-(2-hydroxyethyl)-8-methoxy-4-oxoquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 82251962 |
| Molecular Formula | C13H12ClNO5 |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 5-chloro-1-(2-hydroxyethyl)-8-methoxy-4-oxoquinoline-2-carboxylic acid |
| SMILES | COc1ccc(Cl)c2c(=O)cc(C(=O)O)n(CCO)c12 |
| InChI | InChI=1S/C13H12ClNO5/c1-20-10-3-2-7(14)11-9(17)6-8(13(18)19)15(4-5-16)12(10)11/h2-3,6,16H,4-5H2,1H3,(H,18,19) |
| InChIKey | LFOAJIYPWIWHDR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |