C12H11NO4 — CID 82243055
1-(2-hydroxyethyl)-4-oxoquinoline-2-carboxylic acid (PubChem CID 82243055) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-4-oxoquinoline-2-carboxylic acid.
| Compound Name | 1-(2-hydroxyethyl)-4-oxoquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 82243055 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 1-(2-hydroxyethyl)-4-oxoquinoline-2-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)c2ccccc2n1CCO |
| InChI | InChI=1S/C12H11NO4/c14-6-5-13-9-4-2-1-3-8(9)11(15)7-10(13)12(16)17/h1-4,7,14H,5-6H2,(H,16,17) |
| InChIKey | SGEMZJZBHSMANM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |