C12H10ClNO4 — CID 82247120
6-chloro-1-(2-hydroxyethyl)-4-oxoquinoline-2-carboxylic acid (PubChem CID 82247120) has the molecular formula C12H10ClNO4 and a molecular weight of 267.67 g/mol. Its IUPAC name is 6-chloro-1-(2-hydroxyethyl)-4-oxoquinoline-2-carboxylic acid.
| Compound Name | 6-chloro-1-(2-hydroxyethyl)-4-oxoquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 82247120 |
| Molecular Formula | C12H10ClNO4 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 6-chloro-1-(2-hydroxyethyl)-4-oxoquinoline-2-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)c2cc(Cl)ccc2n1CCO |
| InChI | InChI=1S/C12H10ClNO4/c13-7-1-2-9-8(5-7)11(16)6-10(12(17)18)14(9)3-4-15/h1-2,5-6,15H,3-4H2,(H,17,18) |
| InChIKey | XEUHOYJZMQSCJX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |