C14H12ClFN2O2S — CID 142737251
2-chloro-4-(3-fluorophenyl)sulfonyl-5,6,7,8-tetrahydroquinazoline (PubChem CID 142737251) has the molecular formula C14H12ClFN2O2S and a molecular weight of 326.78 g/mol. Its IUPAC name is 2-chloro-4-(3-fluorophenyl)sulfonyl-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 2-chloro-4-(3-fluorophenyl)sulfonyl-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 142737251 |
| Molecular Formula | C14H12ClFN2O2S |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 2-chloro-4-(3-fluorophenyl)sulfonyl-5,6,7,8-tetrahydroquinazoline |
| SMILES | O=S(=O)(c1cccc(F)c1)c1nc(Cl)nc2c1CCCC2 |
| InChI | InChI=1S/C14H12ClFN2O2S/c15-14-17-12-7-2-1-6-11(12)13(18-14)21(19,20)10-5-3-4-9(16)8-10/h3-5,8H,1-2,6-7H2 |
| InChIKey | CRYBFRKQUMQPHY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |