C19H23N5O2S — CID 142737326
2-(4-methylpiperazin-1-yl)-4-(3-nitrophenyl)sulfanyl-5,6,7,8-tetrahydroquinazoline (PubChem CID 142737326) has the molecular formula C19H23N5O2S and a molecular weight of 385.49 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-4-(3-nitrophenyl)sulfanyl-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 2-(4-methylpiperazin-1-yl)-4-(3-nitrophenyl)sulfanyl-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 142737326 |
| Molecular Formula | C19H23N5O2S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-4-(3-nitrophenyl)sulfanyl-5,6,7,8-tetrahydroquinazoline |
| SMILES | CN1CCN(c2nc3c(c(Sc4cccc([N+](=O)[O-])c4)n2)CCCC3)CC1 |
| InChI | InChI=1S/C19H23N5O2S/c1-22-9-11-23(12-10-22)19-20-17-8-3-2-7-16(17)18(21-19)27-15-6-4-5-14(13-15)24(25)26/h4-6,13H,2-3,7-12H2,1H3 |
| InChIKey | JGNKRUVMYIDZRP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|