C58H98O16 — CID 142738394
2-ethoxy-1-[7-[3,6,7-tris[7-(2-ethoxy-1-hydroxyethoxy)heptoxy]anthracen-2-yl]oxyheptoxy]ethanol (PubChem CID 142738394) has the molecular formula C58H98O16 and a molecular weight of 1051.41 g/mol. Its IUPAC name is 2-ethoxy-1-[7-[3,6,7-tris[7-(2-ethoxy-1-hydroxyethoxy)heptoxy]anthracen-2-yl]oxyheptoxy]ethanol.
| Compound Name | 2-ethoxy-1-[7-[3,6,7-tris[7-(2-ethoxy-1-hydroxyethoxy)heptoxy]anthracen-2-yl]oxyheptoxy]ethanol |
|---|---|
| PubChem CID | 142738394 |
| Molecular Formula | C58H98O16 |
| Molecular Weight | 1051.41 g/mol |
| Exact Mass | 1050.69 |
| IUPAC Name | 2-ethoxy-1-[7-[3,6,7-tris[7-(2-ethoxy-1-hydroxyethoxy)heptoxy]anthracen-2-yl]oxyheptoxy]ethanol |
| SMILES | CCOCC(O)OCCCCCCCOc1cc2cc3cc(OCCCCCCCOC(O)COCC)c(OCCCCCCCOC(O)COCC)cc3cc2cc1OCCCCCCCOC(O)COCC |
| InChI | InChI=1S/C58H98O16/c1-5-63-43-55(59)71-33-25-17-9-13-21-29-67-51-39-47-37-49-41-53(69-31-23-15-11-19-27-35-73-57(61)45-65-7-3)54(70-32-24-16-12-20-28-36-74-58(62)46-66-8-4)42-50(49)38-48(47)40-52(51)68-30-22-14-10-18-26-34-72-56(60)44-64-6-2/h37-42,55-62H,5-36,43-46H2,1-4H3 |
| InChIKey | QDEUVRUVASXAFU-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 191.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1051.41 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|