C19H18BrNO2 — CID 142738542
ethyl 3-[4-amino-3-[2-(3-bromophenyl)ethynyl]phenyl]propanoate (PubChem CID 142738542) has the molecular formula C19H18BrNO2 and a molecular weight of 372.26 g/mol. Its IUPAC name is ethyl 3-[4-amino-3-[2-(3-bromophenyl)ethynyl]phenyl]propanoate.
| Compound Name | ethyl 3-[4-amino-3-[2-(3-bromophenyl)ethynyl]phenyl]propanoate |
|---|---|
| PubChem CID | 142738542 |
| Molecular Formula | C19H18BrNO2 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | ethyl 3-[4-amino-3-[2-(3-bromophenyl)ethynyl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(N)c(C#Cc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C19H18BrNO2/c1-2-23-19(22)11-8-15-7-10-18(21)16(12-15)9-6-14-4-3-5-17(20)13-14/h3-5,7,10,12-13H,2,8,11,21H2,1H3 |
| InChIKey | DWOVGJXXUGUVOL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|