C17H12FN3OS2 — CID 142739260
O-[[7-(4-cyano-3-fluorophenyl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate (PubChem CID 142739260) has the molecular formula C17H12FN3OS2 and a molecular weight of 357.44 g/mol. Its IUPAC name is O-[[7-(4-cyano-3-fluorophenyl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate.
| Compound Name | O-[[7-(4-cyano-3-fluorophenyl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 142739260 |
| Molecular Formula | C17H12FN3OS2 |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | O-[[7-(4-cyano-3-fluorophenyl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=S)Oc1ccc2cnsc2c1-c1ccc(C#N)c(F)c1 |
| InChI | InChI=1S/C17H12FN3OS2/c1-21(2)17(23)22-14-6-5-12-9-20-24-16(12)15(14)10-3-4-11(8-19)13(18)7-10/h3-7,9H,1-2H3 |
| InChIKey | FUEYMOPCJBVANF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|