C14H8N2S2 — CID 175011719
3-(6-sulfanyl-1,2-benzothiazol-7-yl)benzonitrile (PubChem CID 175011719) has the molecular formula C14H8N2S2 and a molecular weight of 268.37 g/mol. Its IUPAC name is 3-(6-sulfanyl-1,2-benzothiazol-7-yl)benzonitrile.
| Compound Name | 3-(6-sulfanyl-1,2-benzothiazol-7-yl)benzonitrile |
|---|---|
| PubChem CID | 175011719 |
| Molecular Formula | C14H8N2S2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 3-(6-sulfanyl-1,2-benzothiazol-7-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2c(S)ccc3cnsc23)c1 |
| InChI | InChI=1S/C14H8N2S2/c15-7-9-2-1-3-10(6-9)13-12(17)5-4-11-8-16-18-14(11)13/h1-6,8,17H |
| InChIKey | RRBGCLRDSHXKRK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 36.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|