C17H11NS — CID 175013764
3-(2-sulfanylnaphthalen-1-yl)benzonitrile (PubChem CID 175013764) has the molecular formula C17H11NS and a molecular weight of 261.35 g/mol. Its IUPAC name is 3-(2-sulfanylnaphthalen-1-yl)benzonitrile.
| Compound Name | 3-(2-sulfanylnaphthalen-1-yl)benzonitrile |
|---|---|
| PubChem CID | 175013764 |
| Molecular Formula | C17H11NS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 3-(2-sulfanylnaphthalen-1-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2c(S)ccc3ccccc23)c1 |
| InChI | InChI=1S/C17H11NS/c18-11-12-4-3-6-14(10-12)17-15-7-2-1-5-13(15)8-9-16(17)19/h1-10,19H |
| InChIKey | IFVQDJUYBUDKMM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 23.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|