C13H17FN2O4 — CID 142739299
3-(2,3-dihydro-1H-isoindol-1-yl)-3-fluoro-1-hydroxypiperidine-2,2,6-triol (PubChem CID 142739299) has the molecular formula C13H17FN2O4 and a molecular weight of 284.29 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-isoindol-1-yl)-3-fluoro-1-hydroxypiperidine-2,2,6-triol.
| Compound Name | 3-(2,3-dihydro-1H-isoindol-1-yl)-3-fluoro-1-hydroxypiperidine-2,2,6-triol |
|---|---|
| PubChem CID | 142739299 |
| Molecular Formula | C13H17FN2O4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-(2,3-dihydro-1H-isoindol-1-yl)-3-fluoro-1-hydroxypiperidine-2,2,6-triol |
| SMILES | OC1CCC(F)(C2NCc3ccccc32)C(O)(O)N1O |
| InChI | InChI=1S/C13H17FN2O4/c14-12(6-5-10(17)16(20)13(12,18)19)11-9-4-2-1-3-8(9)7-15-11/h1-4,10-11,15,17-20H,5-7H2 |
| InChIKey | CQPUMPAEYUNQBB-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|