About 8-oxa-1,2-dithiaspiro[2.5]octane
8-oxa-1,2-dithiaspiro[2.5]octane (PubChem CID 142744258) has the molecular formula C5H8OS2
and a molecular weight of 148.25 g/mol. Its IUPAC name is 8-oxa-1,2-dithiaspiro[2.5]octane.
Molecular Properties
| Compound Name | 8-oxa-1,2-dithiaspiro[2.5]octane |
| PubChem CID | 142744258 |
| Molecular Formula | C5H8OS2 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.00 |
| IUPAC Name | 8-oxa-1,2-dithiaspiro[2.5]octane |
| SMILES | C1CCC2(OC1)SS2 |
| InChI | InChI=1S/C5H8OS2/c1-2-4-6-5(3-1)7-8-5/h1-4H2 |
| InChIKey | RUNXZBJGZBBIQG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 8-oxa-1,2-dithiaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxa-1,2-dithiaspiro[2.5]octane?
The IUPAC name of 8-oxa-1,2-dithiaspiro[2.5]octane (CID 142744258) is 8-oxa-1,2-dithiaspiro[2.5]octane.
What is the SMILES notation for 8-oxa-1,2-dithiaspiro[2.5]octane?
The canonical SMILES for 8-oxa-1,2-dithiaspiro[2.5]octane is C1CCC2(OC1)SS2.
What is the InChIKey of 8-oxa-1,2-dithiaspiro[2.5]octane?
The InChIKey is RUNXZBJGZBBIQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8OS2/c1-2-4-6-5(3-1)7-8-5/h1-4H2.
What are the key properties of 8-oxa-1,2-dithiaspiro[2.5]octane?
8-oxa-1,2-dithiaspiro[2.5]octane has a molecular weight of 148.25 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxa-1,2-dithiaspiro[2.5]octane is sourced from PubChem (CID 142744258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).