C23H29N5O2S — CID 142744783
1-[3-methoxy-4-(1-pyridin-4-ylpropoxy)phenyl]-3-[3-(5-methylimidazol-1-yl)propyl]thiourea (PubChem CID 142744783) has the molecular formula C23H29N5O2S and a molecular weight of 439.59 g/mol. Its IUPAC name is 1-[3-methoxy-4-(1-pyridin-4-ylpropoxy)phenyl]-3-[3-(5-methylimidazol-1-yl)propyl]thiourea.
| Compound Name | 1-[3-methoxy-4-(1-pyridin-4-ylpropoxy)phenyl]-3-[3-(5-methylimidazol-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 142744783 |
| Molecular Formula | C23H29N5O2S |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 1-[3-methoxy-4-(1-pyridin-4-ylpropoxy)phenyl]-3-[3-(5-methylimidazol-1-yl)propyl]thiourea |
| SMILES | CCC(Oc1ccc(NC(=S)NCCCn2cncc2C)cc1OC)c1ccncc1 |
| InChI | InChI=1S/C23H29N5O2S/c1-4-20(18-8-11-24-12-9-18)30-21-7-6-19(14-22(21)29-3)27-23(31)26-10-5-13-28-16-25-15-17(28)2/h6-9,11-12,14-16,20H,4-5,10,13H2,1-3H3,(H2,26,27,31) |
| InChIKey | LGELRYMAGKGMRM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 73.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|