C17H20N4O3 — CID 142744939
2-[4-[(4-methoxyphenyl)methyl]-2,3-dihydropyrido[3,2-b][1,4]oxazin-2-yl]acetohydrazide (PubChem CID 142744939) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-[4-[(4-methoxyphenyl)methyl]-2,3-dihydropyrido[3,2-b][1,4]oxazin-2-yl]acetohydrazide.
| Compound Name | 2-[4-[(4-methoxyphenyl)methyl]-2,3-dihydropyrido[3,2-b][1,4]oxazin-2-yl]acetohydrazide |
|---|---|
| PubChem CID | 142744939 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-[4-[(4-methoxyphenyl)methyl]-2,3-dihydropyrido[3,2-b][1,4]oxazin-2-yl]acetohydrazide |
| SMILES | COc1ccc(CN2CC(CC(=O)NN)Oc3cccnc32)cc1 |
| InChI | InChI=1S/C17H20N4O3/c1-23-13-6-4-12(5-7-13)10-21-11-14(9-16(22)20-18)24-15-3-2-8-19-17(15)21/h2-8,14H,9-11,18H2,1H3,(H,20,22) |
| InChIKey | DGAGGTMOTMECBV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|